CAS 1839060-95-5 is the registry number for tert-Butyl 7-oxo-2,5,8-triazaspiro(3.5)nonane-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 7-oxo-2,5,8-triazaspiro[3.5]nonane-2-carboxylate (CAS 1839060-95-5) is a chemical compound with the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. IUPAC name: tert-butyl 7-oxo-2,5,8-triazaspiro[3.5]nonane-2-carboxylate. InChIKey: LQKWXSRGSJWWND-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O3 |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | tert-butyl 7-oxo-2,5,8-triazaspiro[3.5]nonane-2-carboxylate |
| InChIKey | LQKWXSRGSJWWND-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CNC(=O)CN2 |
Computed by PubChem (NCBI)