Products 1839104-78-7
CAS 1839104-78-7 appears in our catalog under these names: Mukanadin C, 7-bromo-4-hydroxy-1H,2H,3H,4H-pyrrolo[1,2-a]pyrazin-1-one. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
7-bromo-4-hydroxy-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one (CAS 1839104-78-7) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: 7-bromo-4-hydroxy-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one. InChIKey: OBNHKRQJEMDNIG-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | 7-bromo-4-hydroxy-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
| InChIKey | OBNHKRQJEMDNIG-UHFFFAOYSA-N |
| SMILES | C1C(N2C=C(C=C2C(=O)N1)Br)O |
Computed by PubChem (NCBI)