CAS 1839719-62-8 appears in our catalog under these names: 3-Amino-N-((2-fluorophenyl)methyl)benzamide hydrochloride, 95%, 3-Amino-N-((2-fluorophenyl)methyl)benzamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-amino-N-[(2-fluorophenyl)methyl]benzamide;hydrochloride (CAS 1839719-62-8) is a chemical compound with the molecular formula C14H14ClFN2O and a molecular weight of 280.72 g/mol. IUPAC name: 3-amino-N-[(2-fluorophenyl)methyl]benzamide;hydrochloride. InChIKey: XFORYIFCHLMTMR-UHFFFAOYSA-N.
| Molecular formula | C14H14ClFN2O |
|---|---|
| Molecular weight | 280.72 g/mol |
| IUPAC name | 3-amino-N-[(2-fluorophenyl)methyl]benzamide;hydrochloride |
| InChIKey | XFORYIFCHLMTMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC(=O)C2=CC(=CC=C2)N)F.Cl |
Computed by PubChem (NCBI)