CAS 184003-30-3 appears in our catalog under these names: 2,4-Dichloro-1-(2-isothiocyanatoethyl)benzene, 95%, 2,4-Dichloro-1-(2-isothiocyanatoethyl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2,4-dichloro-1-(2-isothiocyanatoethyl)benzene (CAS 184003-30-3) is a chemical compound with the molecular formula C9H7Cl2NS and a molecular weight of 232.13 g/mol. IUPAC name: 2,4-dichloro-1-(2-isothiocyanatoethyl)benzene. InChIKey: LDDSGQQPUHCKKC-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NS |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 2,4-dichloro-1-(2-isothiocyanatoethyl)benzene |
| InChIKey | LDDSGQQPUHCKKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CCN=C=S |
Computed by PubChem (NCBI)