CAS 1840220-19-0 is the registry number for (1-((3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl)pyrrolidin-2-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]pyrrolidin-2-yl]methanamine (CAS 1840220-19-0) is a chemical compound with the molecular formula C10H18N4O2S and a molecular weight of 258.34 g/mol. IUPAC name: [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]pyrrolidin-2-yl]methanamine. InChIKey: UMMLMIGKQPBKLO-UHFFFAOYSA-N.
| Molecular formula | C10H18N4O2S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | [1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]pyrrolidin-2-yl]methanamine |
| InChIKey | UMMLMIGKQPBKLO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)N2CCCC2CN |
Computed by PubChem (NCBI)