CAS 18403-18-4 is the registry number for Benzyl 2,4-di-O-benzoyl-D-xylopyranoside. Offered by: Biosynth. Available pack sizes: 1g.
[(3R,4S,5R,6S)-5-benzoyloxy-4-hydroxy-6-phenylmethoxyoxan-3-yl] benzoate (CAS 18403-18-4) is a chemical compound with the molecular formula C26H24O7 and a molecular weight of 448.5 g/mol. IUPAC name: [(3R,4S,5R,6S)-5-benzoyloxy-4-hydroxy-6-phenylmethoxyoxan-3-yl] benzoate. InChIKey: IAVXGOHFSIPDOM-VUMQFKOGSA-N.
| Molecular formula | C26H24O7 |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | [(3R,4S,5R,6S)-5-benzoyloxy-4-hydroxy-6-phenylmethoxyoxan-3-yl] benzoate |
| InChIKey | IAVXGOHFSIPDOM-VUMQFKOGSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@H](O1)OCC2=CC=CC=C2)OC(=O)C3=CC=CC=C3)O)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)