CAS 18404-86-9 appears in our catalog under these names: (2S,3R,4S,5R)–2–(2–chloroethoxy)tetrahydro–2H–pyran–3,4,5–triyl triacetate, 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 2g, 5g, 10g.
[(3R,4S,5R,6S)-4,5-diacetyloxy-6-(2-chloroethoxy)oxan-3-yl] acetate (CAS 18404-86-9) is a chemical compound with the molecular formula C13H19ClO8 and a molecular weight of 338.74 g/mol. IUPAC name: [(3R,4S,5R,6S)-4,5-diacetyloxy-6-(2-chloroethoxy)oxan-3-yl] acetate. InChIKey: SQGPFYUBBBSLDW-YVECIDJPSA-N.
| Molecular formula | C13H19ClO8 |
|---|---|
| Molecular weight | 338.74 g/mol |
| IUPAC name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-(2-chloroethoxy)oxan-3-yl] acetate |
| InChIKey | SQGPFYUBBBSLDW-YVECIDJPSA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)OCCCl |
Computed by PubChem (NCBI)