CAS 1840869-90-0 is the registry number for 5,5'-(Benzo[c][1,2,5]oxadiazole-4,7-diyl)diisophthalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-(3,5-dicarboxyphenyl)-2,1,3-benzoxadiazol-7-yl]benzene-1,3-dicarboxylic acid (CAS 1840869-90-0) is a chemical compound with the molecular formula C22H12N2O9 and a molecular weight of 448.3 g/mol. IUPAC name: 5-[4-(3,5-dicarboxyphenyl)-2,1,3-benzoxadiazol-7-yl]benzene-1,3-dicarboxylic acid. InChIKey: CBBRMMYPOHWODJ-UHFFFAOYSA-N.
| Molecular formula | C22H12N2O9 |
|---|---|
| Molecular weight | 448.3 g/mol |
| IUPAC name | 5-[4-(3,5-dicarboxyphenyl)-2,1,3-benzoxadiazol-7-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | CBBRMMYPOHWODJ-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)C3=CC(=CC(=C3)C(=O)O)C(=O)O)C4=CC(=CC(=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)