Products 1840896-10-7
CAS 1840896-10-7 is the registry number for Cx43 HC-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] quinoline-2-carboxylate (CAS 1840896-10-7) is a chemical compound with the molecular formula C24H16ClNO3 and a molecular weight of 401.8 g/mol. IUPAC name: [(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] quinoline-2-carboxylate. InChIKey: WOKCOSHBOZBKRP-HSZRJFAPSA-N.
| Molecular formula | C24H16ClNO3 |
|---|---|
| Molecular weight | 401.8 g/mol |
| IUPAC name | [(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] quinoline-2-carboxylate |
| InChIKey | WOKCOSHBOZBKRP-HSZRJFAPSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(=O)C2=CC=C(C=C2)Cl)OC(=O)C3=NC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)