Products 18409-49-9

CAS 18409-49-9 appears in our catalog under these names: Carbamoyl-dl-ala-oh, 95%, (S)-2-ureidopropanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 100mg.

Structural formula: {0} (CAS {1})

(2S)-2-(carbamoylamino)propanoic acid (CAS 18409-49-9) is a chemical compound with the molecular formula C4H8N2O3 and a molecular weight of 132.12 g/mol. IUPAC name: (2S)-2-(carbamoylamino)propanoic acid. InChIKey: LUSWEUMSEVLFEQ-REOHCLBHSA-N.

Identity
Molecular formulaC4H8N2O3
Molecular weight132.12 g/mol
IUPAC name(2S)-2-(carbamoylamino)propanoic acid
InChIKeyLUSWEUMSEVLFEQ-REOHCLBHSA-N
SMILESC[C@@H](C(=O)O)NC(=O)N

Computed by PubChem (NCBI)