CAS 1841081-71-7 is the registry number for Topiroxostat Impurity 41. Offered by: Chemat Brand. Available pack sizes: on request.
N-[[amino(pyridin-4-yl)methylidene]amino]-2-cyanopyridine-4-carboxamide (CAS 1841081-71-7) is a chemical compound with the molecular formula C13H10N6O and a molecular weight of 266.26 g/mol. IUPAC name: N-[[amino(pyridin-4-yl)methylidene]amino]-2-cyanopyridine-4-carboxamide. InChIKey: AOJXMRPVURFLGU-UHFFFAOYSA-N.
| Molecular formula | C13H10N6O |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | N-[[amino(pyridin-4-yl)methylidene]amino]-2-cyanopyridine-4-carboxamide |
| InChIKey | AOJXMRPVURFLGU-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C(=NNC(=O)C2=CC(=NC=C2)C#N)N |
Computed by PubChem (NCBI)