Products 184109-83-9
CAS 184109-83-9 appears in our catalog under these names: 4-Chloro-2-phenyl-6-(trifluoromethyl)pyrimidine, 90%, 4–Chloro–2–phenyl–6–trifluoroMethyl–pyriMidine, 4-Chloro-2-phenyl-6-(trifluoromethyl)pyrimidine. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 200mg, 0,5g, 50mg.
4-chloro-2-phenyl-6-(trifluoromethyl)pyrimidine (CAS 184109-83-9) is a chemical compound with the molecular formula C11H6ClF3N2 and a molecular weight of 258.62 g/mol. IUPAC name: 4-chloro-2-phenyl-6-(trifluoromethyl)pyrimidine. InChIKey: CWZUWJRMFIDBRA-UHFFFAOYSA-N.
| Molecular formula | C11H6ClF3N2 |
|---|---|
| Molecular weight | 258.62 g/mol |
| IUPAC name | 4-chloro-2-phenyl-6-(trifluoromethyl)pyrimidine |
| InChIKey | CWZUWJRMFIDBRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC(=N2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)