CAS 1841091-74-4 is the registry number for methyl N-acetyl-N-methyl-D-alaninate. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R)-2-[acetyl(methyl)amino]propanoate (CAS 1841091-74-4) is a chemical compound with the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. IUPAC name: methyl (2R)-2-[acetyl(methyl)amino]propanoate. InChIKey: UKIKHEWVWGJTLN-RXMQYKEDSA-N.
| Molecular formula | C7H13NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | methyl (2R)-2-[acetyl(methyl)amino]propanoate |
| InChIKey | UKIKHEWVWGJTLN-RXMQYKEDSA-N |
| SMILES | C[C@H](C(=O)OC)N(C)C(=O)C |
Computed by PubChem (NCBI)