CAS 1841094-21-0 is the registry number for 4'-Des-morpholino,-4'-amino Momelotinib. Offered by: TRC. Available pack sizes: 100mg, 10mg.
4-[2-(4-aminoanilino)pyrimidin-4-yl]-N-(cyanomethyl)benzamide (CAS 1841094-21-0) is a chemical compound with the molecular formula C19H16N6O and a molecular weight of 344.4 g/mol. IUPAC name: 4-[2-(4-aminoanilino)pyrimidin-4-yl]-N-(cyanomethyl)benzamide. InChIKey: IAOCNVXPAVHLPY-UHFFFAOYSA-N.
| Molecular formula | C19H16N6O |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 4-[2-(4-aminoanilino)pyrimidin-4-yl]-N-(cyanomethyl)benzamide |
| InChIKey | IAOCNVXPAVHLPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NC=C2)NC3=CC=C(C=C3)N)C(=O)NCC#N |
Computed by PubChem (NCBI)