CAS 18413-36-0 appears in our catalog under these names: N'-Carbamimidoyl-4-methylpiperazine-1-carboximidamide dihydrochloride, 98%, 1-(Amino(4-methylpiperazin-1-yl)methylidene)guanidine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 50mg, 0,5g.
N-(diaminomethylidene)-4-methylpiperazine-1-carboximidamide;dihydrochloride (CAS 18413-36-0) is a chemical compound with the molecular formula C7H18Cl2N6 and a molecular weight of 257.16 g/mol. IUPAC name: N-(diaminomethylidene)-4-methylpiperazine-1-carboximidamide;dihydrochloride. InChIKey: QJYSUWVNNKZHDV-UHFFFAOYSA-N.
| Molecular formula | C7H18Cl2N6 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | N-(diaminomethylidene)-4-methylpiperazine-1-carboximidamide;dihydrochloride |
| InChIKey | QJYSUWVNNKZHDV-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=N)N=C(N)N.Cl.Cl |
Computed by PubChem (NCBI)