CAS 1841371-52-5 is the registry number for N-((1S,2R)-2-(Trifluoromethyl)cyclopentyl)thietan-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1S,2R)-2-(trifluoromethyl)cyclopentyl]thietan-3-amine (CAS 1841371-52-5) is a chemical compound with the molecular formula C9H14F3NS and a molecular weight of 225.28 g/mol. IUPAC name: N-[(1S,2R)-2-(trifluoromethyl)cyclopentyl]thietan-3-amine. InChIKey: KARHIILJFOJMIE-SFYZADRCSA-N.
| Molecular formula | C9H14F3NS |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | N-[(1S,2R)-2-(trifluoromethyl)cyclopentyl]thietan-3-amine |
| InChIKey | KARHIILJFOJMIE-SFYZADRCSA-N |
| SMILES | C1C[C@H]([C@H](C1)NC2CSC2)C(F)(F)F |
Computed by PubChem (NCBI)