Products 184147-65-7
CAS 184147-65-7 is the registry number for FR-181074. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2-chlorophenyl)methyl]-3-(2-methylpropanoyl)-2-propylindole-6-carboxamide (CAS 184147-65-7) is a chemical compound with the molecular formula C23H25ClN2O2 and a molecular weight of 396.9 g/mol. IUPAC name: 1-[(2-chlorophenyl)methyl]-3-(2-methylpropanoyl)-2-propylindole-6-carboxamide. InChIKey: WWXPHRJCGKFIQK-UHFFFAOYSA-N.
| Molecular formula | C23H25ClN2O2 |
|---|---|
| Molecular weight | 396.9 g/mol |
| IUPAC name | 1-[(2-chlorophenyl)methyl]-3-(2-methylpropanoyl)-2-propylindole-6-carboxamide |
| InChIKey | WWXPHRJCGKFIQK-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C2=C(N1CC3=CC=CC=C3Cl)C=C(C=C2)C(=O)N)C(=O)C(C)C |
Computed by PubChem (NCBI)