CAS 18419-84-6 appears in our catalog under these names: 1,2-Diethoxy-1,1,2,2-tetramethyldisilane, 97%, 1,2-DIETHOXY-1,1,2,2-TETRAMETHYLDISILAN&. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g, 5g, 250mg.
Ethoxy-[ethoxy(dimethyl)silyl]-dimethylsilane (CAS 18419-84-6) is a chemical compound with the molecular formula C8H22O2Si2 and a molecular weight of 206.43 g/mol. IUPAC name: ethoxy-[ethoxy(dimethyl)silyl]-dimethylsilane. InChIKey: GWIVSKPSMYHUAK-UHFFFAOYSA-N.
| Molecular formula | C8H22O2Si2 |
|---|---|
| Molecular weight | 206.43 g/mol |
| IUPAC name | ethoxy-[ethoxy(dimethyl)silyl]-dimethylsilane |
| InChIKey | GWIVSKPSMYHUAK-UHFFFAOYSA-N |
| SMILES | CCO[Si](C)(C)[Si](C)(C)OCC |
Computed by PubChem (NCBI)