CAS 18420-09-2 appears in our catalog under these names: 1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane, 1,3–Diethoxy–1,1,3,3–tetramethyldisiloxane, 1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane 95%, 1,1,3,3-Tetramethyl-1,3-diethoxydisiloxane, 95%. Offered by: TRC, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 500mg, 5g, 25ml, 5ml, 25g, 100g.
Ethoxy-[ethoxy(dimethyl)silyl]oxy-dimethylsilane (CAS 18420-09-2) is a chemical compound with the molecular formula C8H22O3Si2 and a molecular weight of 222.43 g/mol. IUPAC name: ethoxy-[ethoxy(dimethyl)silyl]oxy-dimethylsilane. InChIKey: NPOYZXWZANURMM-UHFFFAOYSA-N.
| Molecular formula | C8H22O3Si2 |
|---|---|
| Molecular weight | 222.43 g/mol |
| IUPAC name | ethoxy-[ethoxy(dimethyl)silyl]oxy-dimethylsilane |
| InChIKey | NPOYZXWZANURMM-UHFFFAOYSA-N |
| SMILES | CCO[Si](C)(C)O[Si](C)(C)OCC |
Computed by PubChem (NCBI)