Products 184222-90-0

CAS 184222-90-0 appears in our catalog under these names: 5-Methyl-1,3,4-thiadiazole-2-sulfonyl chloride 95%, 5-Methyl-1,3,4-thiadiazole-2-sulfonyl chloride, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-methyl-1,3,4-thiadiazole-2-sulfonyl chloride (CAS 184222-90-0) is a chemical compound with the molecular formula C3H3ClN2O2S2 and a molecular weight of 198.7 g/mol. IUPAC name: 5-methyl-1,3,4-thiadiazole-2-sulfonyl chloride. InChIKey: PFXXMBKPEWGNCT-UHFFFAOYSA-N.

Identity
Molecular formulaC3H3ClN2O2S2
Molecular weight198.7 g/mol
IUPAC name5-methyl-1,3,4-thiadiazole-2-sulfonyl chloride
InChIKeyPFXXMBKPEWGNCT-UHFFFAOYSA-N
SMILESCC1=NN=C(S1)S(=O)(=O)Cl

Computed by PubChem (NCBI)