Products 1842340-93-5
CAS 1842340-93-5 is the registry number for DDO-3055. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 10 mg, 5 mg.
2-[[5-[3-(4-chlorophenoxy)prop-1-ynyl]-3-hydroxypyridine-2-carbonyl]amino]acetic acid (CAS 1842340-93-5) is a chemical compound with the molecular formula C17H13ClN2O5 and a molecular weight of 360.7 g/mol. IUPAC name: 2-[[5-[3-(4-chlorophenoxy)prop-1-ynyl]-3-hydroxypyridine-2-carbonyl]amino]acetic acid. InChIKey: AIKDJELJHUPYNG-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O5 |
|---|---|
| Molecular weight | 360.7 g/mol |
| IUPAC name | 2-[[5-[3-(4-chlorophenoxy)prop-1-ynyl]-3-hydroxypyridine-2-carbonyl]amino]acetic acid |
| InChIKey | AIKDJELJHUPYNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC#CC2=CC(=C(N=C2)C(=O)NCC(=O)O)O)Cl |
Computed by PubChem (NCBI)