CAS 1842393-49-0 is the registry number for 5'-(4-Carboxyphenyl)-2'-methoxy-4'-methyl-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3,5-bis(4-carboxyphenyl)-4-methoxy-2-methylphenyl]benzoic acid (CAS 1842393-49-0) is a chemical compound with the molecular formula C29H22O7 and a molecular weight of 482.5 g/mol. IUPAC name: 4-[3,5-bis(4-carboxyphenyl)-4-methoxy-2-methylphenyl]benzoic acid. InChIKey: WFWJFIAXTCWJTI-UHFFFAOYSA-N.
| Molecular formula | C29H22O7 |
|---|---|
| Molecular weight | 482.5 g/mol |
| IUPAC name | 4-[3,5-bis(4-carboxyphenyl)-4-methoxy-2-methylphenyl]benzoic acid |
| InChIKey | WFWJFIAXTCWJTI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O)OC)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)