Products 13459-13-7
CAS 13459-13-7 is the registry number for RuDiOBn. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,5-dihydroxy-2-(3-hydroxy-4-phenylmethoxyphenyl)-7-phenylmethoxychromen-4-one (CAS 13459-13-7) is a chemical compound with the molecular formula C29H22O7 and a molecular weight of 482.5 g/mol. IUPAC name: 3,5-dihydroxy-2-(3-hydroxy-4-phenylmethoxyphenyl)-7-phenylmethoxychromen-4-one. InChIKey: ANVFWEYJSIPXRO-UHFFFAOYSA-N.
| Molecular formula | C29H22O7 |
|---|---|
| Molecular weight | 482.5 g/mol |
| IUPAC name | 3,5-dihydroxy-2-(3-hydroxy-4-phenylmethoxyphenyl)-7-phenylmethoxychromen-4-one |
| InChIKey | ANVFWEYJSIPXRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C3=C(C(=O)C4=C(C=C(C=C4O3)OCC5=CC=CC=C5)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
RuDiOBn, orb3028919