CAS 1843-35-2 appears in our catalog under these names: 3-Azidobenzoic Acid, 3-Azidobenzoic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 2,5g, 250mg, 50mg, 0,5g.
3-azidobenzoic acid (CAS 1843-35-2) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 3-azidobenzoic acid. InChIKey: XBYIWVXXQSZTFY-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 3-azidobenzoic acid |
| InChIKey | XBYIWVXXQSZTFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)