CAS 18430-85-8 appears in our catalog under these names: Pyrrole-d5, 98 atom % D, min 98% Chemical Purity, Pyrrole–d5, PYRROLE-D5, 98 ATOM % D. Offered by: CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 1g, 0,5g.
1,2,3,4,5-pentadeuteriopyrrole (CAS 18430-85-8) is a chemical compound with the molecular formula C4H5N and a molecular weight of 72.12 g/mol. IUPAC name: 1,2,3,4,5-pentadeuteriopyrrole. InChIKey: KAESVJOAVNADME-HXRFYODMSA-N.
| Molecular formula | C4H5N |
|---|---|
| Molecular weight | 72.12 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuteriopyrrole |
| InChIKey | KAESVJOAVNADME-HXRFYODMSA-N |
| SMILES | [2H]C1=C(N(C(=C1[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)