Products 184302-49-6
CAS 184302-49-6 is the registry number for FF-10502. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-amino-1-[(2R,3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)thiolan-2-yl]pyrimidin-2-one (CAS 184302-49-6) is a chemical compound with the molecular formula C9H12FN3O3S and a molecular weight of 261.28 g/mol. IUPAC name: 4-amino-1-[(2R,3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)thiolan-2-yl]pyrimidin-2-one. InChIKey: NIDPJRZOVFIBQB-PXBUCIJWSA-N.
| Molecular formula | C9H12FN3O3S |
|---|---|
| Molecular weight | 261.28 g/mol |
| IUPAC name | 4-amino-1-[(2R,3S,4S,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)thiolan-2-yl]pyrimidin-2-one |
| InChIKey | NIDPJRZOVFIBQB-PXBUCIJWSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@H]([C@@H]([C@H](S2)CO)O)F |
Computed by PubChem (NCBI)