CAS 18434-87-2 appears in our catalog under these names: H-Cys(so3h)-oh sodium salt, 95%, H-Cys(SO3H)-OH sodium salt. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5g, 10g, 0,5g, 2g.
Sodium (2R)-2-amino-1-hydroxy-1-oxo-3-sulfonatosulfanylpropane (CAS 18434-87-2) is a chemical compound with the molecular formula C3H6NNaO5S2 and a molecular weight of 223.2 g/mol. IUPAC name: sodium (2R)-2-amino-1-hydroxy-1-oxo-3-sulfonatosulfanylpropane. InChIKey: DQFVBELGDROGDO-DKWTVANSSA-M.
| Molecular formula | C3H6NNaO5S2 |
|---|---|
| Molecular weight | 223.2 g/mol |
| IUPAC name | sodium (2R)-2-amino-1-hydroxy-1-oxo-3-sulfonatosulfanylpropane |
| InChIKey | DQFVBELGDROGDO-DKWTVANSSA-M |
| SMILES | C([C@@H](C(=O)O)N)SS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)