Products 1843449-58-0
CAS 1843449-58-0 is the registry number for (2R,5R)-5-Phenylpyrrolidine-2-carboxamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2R,5R)-5-phenylpyrrolidine-2-carboxamide (CAS 1843449-58-0) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: (2R,5R)-5-phenylpyrrolidine-2-carboxamide. InChIKey: YAFZGWDDRQXPLX-NXEZZACHSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | (2R,5R)-5-phenylpyrrolidine-2-carboxamide |
| InChIKey | YAFZGWDDRQXPLX-NXEZZACHSA-N |
| SMILES | C1C[C@@H](N[C@H]1C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)