CAS 1844123-52-9 appears in our catalog under these names: Levetiracetam Impurity 6, Levetiracetam Impurity 5, (2R)-2-((2S)-2-Aminobutanamido)butanamide. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.
(2S)-2-amino-N-[(2R)-1-amino-1-oxobutan-2-yl]butanamide (CAS 1844123-52-9) is a chemical compound with the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. IUPAC name: (2S)-2-amino-N-[(2R)-1-amino-1-oxobutan-2-yl]butanamide. InChIKey: GOEVIAYIADFCTD-NTSWFWBYSA-N.
| Molecular formula | C8H17N3O2 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | (2S)-2-amino-N-[(2R)-1-amino-1-oxobutan-2-yl]butanamide |
| InChIKey | GOEVIAYIADFCTD-NTSWFWBYSA-N |
| SMILES | CC[C@@H](C(=O)N[C@H](CC)C(=O)N)N |
Computed by PubChem (NCBI)