CAS 184475-55-6 appears in our catalog under these names: Gefitinib hydrochloride, 98%, Gefitinib hydrochloride, Gefitinib hydrochloride, Gefitinib HCl 99%, Gefitinib hydrochloride, 99%, 99%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 50mg, 500mg, 1000mg.
N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine;hydrochloride (CAS 184475-55-6) is a chemical compound with the molecular formula C22H25Cl2FN4O3 and a molecular weight of 483.4 g/mol. IUPAC name: N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine;hydrochloride. InChIKey: QUINXWLATMJDQF-UHFFFAOYSA-N.
| Molecular formula | C22H25Cl2FN4O3 |
|---|---|
| Molecular weight | 483.4 g/mol |
| IUPAC name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine;hydrochloride |
| InChIKey | QUINXWLATMJDQF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)Cl)OCCCN4CCOCC4.Cl |
Computed by PubChem (NCBI)