Products 1844894-70-7
CAS 1844894-70-7 is the registry number for Vildagliptin Related Compound 3 (S-Isomer). Offered by: Chemat Brand. Available pack sizes: on request.
(8aS)-2-(3-hydroxy-1-adamantyl)-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (CAS 1844894-70-7) is a chemical compound with the molecular formula C17H24N2O3 and a molecular weight of 304.4 g/mol. IUPAC name: (8aS)-2-(3-hydroxy-1-adamantyl)-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione. InChIKey: XPKCFFJRILBMTQ-FBXIQOIYSA-N.
| Molecular formula | C17H24N2O3 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | (8aS)-2-(3-hydroxy-1-adamantyl)-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | XPKCFFJRILBMTQ-FBXIQOIYSA-N |
| SMILES | C1C[C@H]2C(=O)N(CC(=O)N2C1)C34CC5CC(C3)CC(C5)(C4)O |
Computed by PubChem (NCBI)