CAS 1844898-11-8 is the registry number for (3S,4S)-3-Amino-4-methyl-2-azetidinone Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
(3S,4S)-3-amino-4-methylazetidin-2-one;hydrochloride (CAS 1844898-11-8) is a chemical compound with the molecular formula C4H9ClN2O and a molecular weight of 136.58 g/mol. IUPAC name: (3S,4S)-3-amino-4-methylazetidin-2-one;hydrochloride. InChIKey: HTTZRCWORMLBJP-GVOALSEPSA-N.
| Molecular formula | C4H9ClN2O |
|---|---|
| Molecular weight | 136.58 g/mol |
| IUPAC name | (3S,4S)-3-amino-4-methylazetidin-2-one;hydrochloride |
| InChIKey | HTTZRCWORMLBJP-GVOALSEPSA-N |
| SMILES | C[C@H]1[C@@H](C(=O)N1)N.Cl |
Computed by PubChem (NCBI)