CAS 1844898-15-2 is the registry number for (3R)-1,3-Dimethylpiperazine hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Bis((3R)-1,3-dimethylpiperazine);oxalic acid (CAS 1844898-15-2) is a chemical compound with the molecular formula C14H30N4O4 and a molecular weight of 318.41 g/mol. IUPAC name: bis((3R)-1,3-dimethylpiperazine);oxalic acid. InChIKey: KDSQTEAFUAXQJW-GOPSZHOCSA-N.
| Molecular formula | C14H30N4O4 |
|---|---|
| Molecular weight | 318.41 g/mol |
| IUPAC name | bis((3R)-1,3-dimethylpiperazine);oxalic acid |
| InChIKey | KDSQTEAFUAXQJW-GOPSZHOCSA-N |
| SMILES | C[C@@H]1CN(CCN1)C.C[C@@H]1CN(CCN1)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)