Products 18453-29-7
CAS 18453-29-7 is the registry number for 3-(4-Bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine oxide, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide (CAS 18453-29-7) is a chemical compound with the molecular formula C16H19BrN2O and a molecular weight of 335.24 g/mol. IUPAC name: 3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide. InChIKey: OCQFIQYMXUIYLW-UHFFFAOYSA-N.
| Molecular formula | C16H19BrN2O |
|---|---|
| Molecular weight | 335.24 g/mol |
| IUPAC name | 3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide |
| InChIKey | OCQFIQYMXUIYLW-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCC(C1=CC=C(C=C1)Br)C2=CC=CC=N2)[O-] |
Computed by PubChem (NCBI)