CAS 1845693-93-7 appears in our catalog under these names: (2,7–di–tert–Butyl–9–methyl–9H–fluoren–9–yl)phosphonic acid, (2,7-di-tert-butyl-9-methyl-9H-fluoren-9-yl)phosphonic acid, 98%, 98%, (2,7-di-tert-Butyl-9-methyl-9H-fluoren-9-yl)phosphonic acid, 98%(HPLC),RG. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 100mg, 250mg.
(2,7-ditert-butyl-9-methylfluoren-9-yl)phosphonic acid (CAS 1845693-93-7) is a chemical compound with the molecular formula C22H29O3P and a molecular weight of 372.4 g/mol. IUPAC name: (2,7-ditert-butyl-9-methylfluoren-9-yl)phosphonic acid. InChIKey: JINYPOVDAINLGC-UHFFFAOYSA-N.
| Molecular formula | C22H29O3P |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | (2,7-ditert-butyl-9-methylfluoren-9-yl)phosphonic acid |
| InChIKey | JINYPOVDAINLGC-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)C(C)(C)C)C3=C1C=C(C=C3)C(C)(C)C)P(=O)(O)O |
Computed by PubChem (NCBI)