CAS 1845706-41-3 is the registry number for N-[2-Nitro-5-(trifluoromethyl)phenyl]methanesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[2-nitro-5-(trifluoromethyl)phenyl]methanesulfonamide (CAS 1845706-41-3) is a chemical compound with the molecular formula C8H7F3N2O4S and a molecular weight of 284.21 g/mol. IUPAC name: N-[2-nitro-5-(trifluoromethyl)phenyl]methanesulfonamide. InChIKey: OWFMTTDOFPVFBH-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O4S |
|---|---|
| Molecular weight | 284.21 g/mol |
| IUPAC name | N-[2-nitro-5-(trifluoromethyl)phenyl]methanesulfonamide |
| InChIKey | OWFMTTDOFPVFBH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=CC(=C1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)