CAS 1845706-45-7 appears in our catalog under these names: Sodium 2-(3-chloropyrazin-2-yl)acetic acid, 95%, Sodium 2-(3-chloropyrazin-2-yl)acetic acid, 97%, Sodium 2-(3-chloropyrazin-2-yl)acetic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 500mg.
Sodium 2-(3-chloropyrazin-2-yl)acetate (CAS 1845706-45-7) is a chemical compound with the molecular formula C6H4ClN2NaO2 and a molecular weight of 194.55 g/mol. IUPAC name: sodium 2-(3-chloropyrazin-2-yl)acetate. InChIKey: RMTAAEPFBBKWDD-UHFFFAOYSA-M.
| Molecular formula | C6H4ClN2NaO2 |
|---|---|
| Molecular weight | 194.55 g/mol |
| IUPAC name | sodium 2-(3-chloropyrazin-2-yl)acetate |
| InChIKey | RMTAAEPFBBKWDD-UHFFFAOYSA-M |
| SMILES | C1=CN=C(C(=N1)CC(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)