CAS 18463-11-1 appears in our catalog under these names: Rhizocarpic acid, 95%, Rhizocarpic acid. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 250mg, 100mg, Get quote.
Methyl (2S)-2-[[(2E)-2-(3-hydroxy-5-oxo-4-phenylfuran-2-ylidene)-2-phenylacetyl]amino]-3-phenylpropanoate (CAS 18463-11-1) is a chemical compound with the molecular formula C28H23NO6 and a molecular weight of 469.5 g/mol. IUPAC name: methyl (2S)-2-[[(2E)-2-(3-hydroxy-5-oxo-4-phenylfuran-2-ylidene)-2-phenylacetyl]amino]-3-phenylpropanoate. InChIKey: DKDGWAKCXBFTMM-KZKMBZSSSA-N.
| Molecular formula | C28H23NO6 |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | methyl (2S)-2-[[(2E)-2-(3-hydroxy-5-oxo-4-phenylfuran-2-ylidene)-2-phenylacetyl]amino]-3-phenylpropanoate |
| InChIKey | DKDGWAKCXBFTMM-KZKMBZSSSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)/C(=C/2\C(=C(C(=O)O2)C3=CC=CC=C3)O)/C4=CC=CC=C4 |
Computed by PubChem (NCBI)