CAS 1846634-29-4 is the registry number for ((1R,3S)-3-((Thietan-3-ylamino)methyl)cyclohexyl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,3S)-3-[(thietan-3-ylamino)methyl]cyclohexyl]methanol (CAS 1846634-29-4) is a chemical compound with the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. IUPAC name: [(1R,3S)-3-[(thietan-3-ylamino)methyl]cyclohexyl]methanol. InChIKey: GJRSUGBJVBJGFF-VHSXEESVSA-N.
| Molecular formula | C11H21NOS |
|---|---|
| Molecular weight | 215.36 g/mol |
| IUPAC name | [(1R,3S)-3-[(thietan-3-ylamino)methyl]cyclohexyl]methanol |
| InChIKey | GJRSUGBJVBJGFF-VHSXEESVSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)CO)CNC2CSC2 |
Computed by PubChem (NCBI)