Products 1846685-75-3
CAS 1846685-75-3 is the registry number for tert-Butyl (R)-(1-hydroxypropan-2-yl)(methyl)carbamate, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-[(2R)-1-hydroxypropan-2-yl]-N-methylcarbamate (CAS 1846685-75-3) is a chemical compound with the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydroxypropan-2-yl]-N-methylcarbamate. InChIKey: WEPXAYUSJHQWOO-SSDOTTSWSA-N.
| Molecular formula | C9H19NO3 |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydroxypropan-2-yl]-N-methylcarbamate |
| InChIKey | WEPXAYUSJHQWOO-SSDOTTSWSA-N |
| SMILES | C[C@H](CO)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)