CAS 18469-37-9 appears in our catalog under these names: 4-Bromo-N,N-dimethylbenzamide, 95-<97%, 4-Bromo-N,N-dimethylbenzamide, ≥97-<99%, 4–Bromo–N,N–Dimethylbenzamide, 4-Bromo-N,N-dimethylbenzamide, >98.0%(GC), 4-Bromo-N,N-Dimethylbenzamide, 98%, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 5g.
4-bromo-N,N-dimethylbenzamide (CAS 18469-37-9) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: 4-bromo-N,N-dimethylbenzamide. InChIKey: BRRVYBRXLUEEJP-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | 4-bromo-N,N-dimethylbenzamide |
| InChIKey | BRRVYBRXLUEEJP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)