Products 184698-47-3
CAS 184698-47-3 appears in our catalog under these names: 5-(Bromomethyl)-2-phenylpyrimidine, 95%, 5-(Bromomethyl)-2-phenylpyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-(bromomethyl)-2-phenylpyrimidine (CAS 184698-47-3) is a chemical compound with the molecular formula C11H9BrN2 and a molecular weight of 249.11 g/mol. IUPAC name: 5-(bromomethyl)-2-phenylpyrimidine. InChIKey: OFZDTRPGUOMRKC-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2 |
|---|---|
| Molecular weight | 249.11 g/mol |
| IUPAC name | 5-(bromomethyl)-2-phenylpyrimidine |
| InChIKey | OFZDTRPGUOMRKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C=N2)CBr |
Computed by PubChem (NCBI)