CAS 18472-87-2 appears in our catalog under these names: Phloxine B, >95% (HPLC), Phloxine B, Phloxine B, Acid Red 92, >85.0%(E), Phloxine B, 85%, pure, high purity, Biological stain. Offered by: TRC, Dr. Ehrenstorfer, TargetMol, GLPBio, TCI. Available pack sizes: 10g, 25g, 5g, 100mg, 50g, 100g, 500g, 1g.
Disodium;2',4',5',7'-tetrabromo-4,5,6,7-tetrachloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate (CAS 18472-87-2) is a chemical compound with the molecular formula C20H2Br4Cl4Na2O5 and a molecular weight of 829.6 g/mol. IUPAC name: disodium;2',4',5',7'-tetrabromo-4,5,6,7-tetrachloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate. InChIKey: OOYIOIOOWUGAHD-UHFFFAOYSA-L.
| Molecular formula | C20H2Br4Cl4Na2O5 |
|---|---|
| Molecular weight | 829.6 g/mol |
| IUPAC name | disodium;2',4',5',7'-tetrabromo-4,5,6,7-tetrachloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
| InChIKey | OOYIOIOOWUGAHD-UHFFFAOYSA-L |
| SMILES | C1=C2C(=C(C(=C1Br)[O-])Br)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)Br)[O-])Br.[Na+].[Na+] |
Computed by PubChem (NCBI)