Products 1847442-52-7

CAS 1847442-52-7 is the registry number for 1-Phenylmethyl) Ester 5-hydroxy-N,N-bis(phenylmethyl)-Norvaline. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Benzyl 2-(dibenzylamino)-5-hydroxypentanoate (CAS 1847442-52-7) is a chemical compound with the molecular formula C26H29NO3 and a molecular weight of 403.5 g/mol. IUPAC name: benzyl 2-(dibenzylamino)-5-hydroxypentanoate. InChIKey: FLHNNBIEYWIONI-UHFFFAOYSA-N.

Identity
Molecular formulaC26H29NO3
Molecular weight403.5 g/mol
IUPAC namebenzyl 2-(dibenzylamino)-5-hydroxypentanoate
InChIKeyFLHNNBIEYWIONI-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CN(CC2=CC=CC=C2)C(CCCO)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)