Products 1847442-53-8

CAS 1847442-53-8 is the registry number for Phenylmethyl Ester 5-Oxo-N,N-bis(phenylmethyl)-Norvaline. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Benzyl 2-(dibenzylamino)-5-oxopentanoate (CAS 1847442-53-8) is a chemical compound with the molecular formula C26H27NO3 and a molecular weight of 401.5 g/mol. IUPAC name: benzyl 2-(dibenzylamino)-5-oxopentanoate. InChIKey: SREOBCCTYUETBC-UHFFFAOYSA-N.

Identity
Molecular formulaC26H27NO3
Molecular weight401.5 g/mol
IUPAC namebenzyl 2-(dibenzylamino)-5-oxopentanoate
InChIKeySREOBCCTYUETBC-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CN(CC2=CC=CC=C2)C(CCC=O)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)