Products 1847466-35-6
CAS 1847466-35-6 is the registry number for N-(2-Aminoethyl)-4-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanamide, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
N-(2-aminoethyl)-4-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanamide (CAS 1847466-35-6) is a chemical compound with the molecular formula C14H21N3O6 and a molecular weight of 327.33 g/mol. IUPAC name: N-(2-aminoethyl)-4-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanamide. InChIKey: VENYSJIAOYHYJY-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O6 |
|---|---|
| Molecular weight | 327.33 g/mol |
| IUPAC name | N-(2-aminoethyl)-4-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanamide |
| InChIKey | VENYSJIAOYHYJY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CO)[N+](=O)[O-])OCCCC(=O)NCCN |
Computed by PubChem (NCBI)