Products 18486-69-6
CAS 18486-69-6 appears in our catalog under these names: (-)-Myrtenal, 95%, (−)-Myrtenal/ 98.53% (existing batch purity), (–)–Myrtenal, (-)-Myrtenal, (-)-Myrtenal, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 100g, 5g, 500g, 25g, 1g, 500mg, 0,05kg, 0,1kg.
(1R,5S)-6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-carbaldehyde (CAS 18486-69-6) is a chemical compound with the molecular formula C10H14O and a molecular weight of 150.22 g/mol. IUPAC name: (1R,5S)-6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-carbaldehyde. InChIKey: KMRMUZKLFIEVAO-IUCAKERBSA-N.
| Molecular formula | C10H14O |
|---|---|
| Molecular weight | 150.22 g/mol |
| IUPAC name | (1R,5S)-6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-carbaldehyde |
| InChIKey | KMRMUZKLFIEVAO-IUCAKERBSA-N |
| SMILES | CC1([C@H]2CC=C([C@@H]1C2)C=O)C |
Computed by PubChem (NCBI)