CAS 184874-53-1 appears in our catalog under these names: (2S,3R,4S,5S,6S)–6–((benzyloxy)carbonyl)tetrahydro–2H–pyran–2,3,4,5–tetrayl tetraacetate, 1,2,3,4-Tetra-O-acetyl-β-D-glucopyranuronic acid benzyl ester, 1,2,3,4-Tri-O-acetyl-b-D-glucuronide benzyl ester, 1,2,3,4-Tetra-O-acetyl-b-D-glucuronide benzyl ester. Offered by: GLPBio, Chemat, Biosynth. Available pack sizes: 1g, 2g, 5g, 10g, 500mg, 50g, 250mg, 1000mg.
Benzyl (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate (CAS 184874-53-1) is a chemical compound with the molecular formula C21H24O11 and a molecular weight of 452.4 g/mol. IUPAC name: benzyl (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate. InChIKey: NMPOAPYFTBNPQO-VDRZXAFZSA-N.
| Molecular formula | C21H24O11 |
|---|---|
| Molecular weight | 452.4 g/mol |
| IUPAC name | benzyl (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate |
| InChIKey | NMPOAPYFTBNPQO-VDRZXAFZSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC(=O)C)C(=O)OCC2=CC=CC=C2)OC(=O)C |
Computed by PubChem (NCBI)