CAS 1848864-86-7 is the registry number for (1S,2S)-N-(2,2-Dimethylthietan-3-yl)-2-methylcyclopropane-1-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,2S)-N-(2,2-dimethylthietan-3-yl)-2-methylcyclopropane-1-carboxamide (CAS 1848864-86-7) is a chemical compound with the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. IUPAC name: trans-(1S,2S)-N-(2,2-dimethylthietan-3-yl)-2-methylcyclopropane-1-carboxamide. InChIKey: BSJSTKSYWLYUDO-WPZUCAASSA-N.
| Molecular formula | C10H17NOS |
|---|---|
| Molecular weight | 199.32 g/mol |
| IUPAC name | trans-(1S,2S)-N-(2,2-dimethylthietan-3-yl)-2-methylcyclopropane-1-carboxamide |
| InChIKey | BSJSTKSYWLYUDO-WPZUCAASSA-N |
| SMILES | C[C@H]1C[C@@H]1C(=O)NC2CSC2(C)C |
Computed by PubChem (NCBI)