CAS 184887-64-7 is the registry number for 4-chloro-3,5-dinitrophenol. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3,5-dinitrophenol (CAS 184887-64-7) is a chemical compound with the molecular formula C6H3ClN2O5 and a molecular weight of 218.55 g/mol. IUPAC name: 4-chloro-3,5-dinitrophenol. InChIKey: UNIKOJMONCWIPI-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O5 |
|---|---|
| Molecular weight | 218.55 g/mol |
| IUPAC name | 4-chloro-3,5-dinitrophenol |
| InChIKey | UNIKOJMONCWIPI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)